CAS 1197234-16-4 is the registry number for 3–(2–aminoethyl)–1–oxa–3–azaspiro(4·4)nonane–2,4–dione hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 500mg.
3-(2-aminoethyl)-1-oxa-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride (CAS 1197234-16-4) is a chemical compound with the molecular formula C9H15ClN2O3 and a molecular weight of 234.68 g/mol. IUPAC name: 3-(2-aminoethyl)-1-oxa-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride. InChIKey: AHJBJFFZJLVVIW-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O3 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1-oxa-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride |
| InChIKey | AHJBJFFZJLVVIW-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)O2)CCN.Cl |
Computed by PubChem (NCBI)