CAS 119725-91-6 is the registry number for Propiconazole-4-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-4-carboxylic acid (CAS 119725-91-6) is a chemical compound with the molecular formula C13H11Cl2N3O4 and a molecular weight of 344.15 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-4-carboxylic acid. InChIKey: NUAGPTNJVDKMOR-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2N3O4 |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-4-carboxylic acid |
| InChIKey | NUAGPTNJVDKMOR-UHFFFAOYSA-N |
| SMILES | C1C(OC(O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)