Products 119731-75-8
CAS 119731-75-8 is the registry number for L-662583. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]sulfonylthiophene-2-sulfonamide;hydrochloride (CAS 119731-75-8) is a chemical compound with the molecular formula C13H17ClN2O5S3 and a molecular weight of 412.9 g/mol. IUPAC name: 5-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]sulfonylthiophene-2-sulfonamide;hydrochloride. InChIKey: BFZQSMDOPQCKCT-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O5S3 |
|---|---|
| Molecular weight | 412.9 g/mol |
| IUPAC name | 5-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]sulfonylthiophene-2-sulfonamide;hydrochloride |
| InChIKey | BFZQSMDOPQCKCT-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)S(=O)(=O)C2=CC=C(S2)S(=O)(=O)N)O.Cl |
Computed by PubChem (NCBI)