CAS 1197333-95-1 appears in our catalog under these names: RO 04–6790 hydrochloride, 4-Amino-N-(2,6-bis(methylamino)-4-pyrimidinyl)-benzenesulfonamide dihydrochloride, Ro 04-6790 di(hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, Get quote.
4-amino-N-[2,6-bis(methylamino)pyrimidin-4-yl]benzenesulfonamide;dihydrochloride (CAS 1197333-95-1) is a chemical compound with the molecular formula C12H18Cl2N6O2S and a molecular weight of 381.3 g/mol. IUPAC name: 4-amino-N-[2,6-bis(methylamino)pyrimidin-4-yl]benzenesulfonamide;dihydrochloride. InChIKey: QOAXXMSJHQHSFV-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N6O2S |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | 4-amino-N-[2,6-bis(methylamino)pyrimidin-4-yl]benzenesulfonamide;dihydrochloride |
| InChIKey | QOAXXMSJHQHSFV-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=NC(=N1)NC)NS(=O)(=O)C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)