CAS 119736-51-5 appears in our catalog under these names: 3-Indoxyl-beta-D-glucuronic Acid Sodium Salt, 3-Indolyl b-D-glucuronide sodium salt. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 500mg, 250mg, 1000mg.
Sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylate (CAS 119736-51-5) is a chemical compound with the molecular formula C14H14NNaO7 and a molecular weight of 331.25 g/mol. IUPAC name: sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylate. InChIKey: DBEHJKGNQBSGOE-CYRSAHDMSA-M.
| Molecular formula | C14H14NNaO7 |
|---|---|
| Molecular weight | 331.25 g/mol |
| IUPAC name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(1H-indol-3-yloxy)oxane-2-carboxylate |
| InChIKey | DBEHJKGNQBSGOE-CYRSAHDMSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)[O-])O)O)O.[Na+] |
Computed by PubChem (NCBI)