Products 1197419-14-9
CAS 1197419-14-9 is the registry number for tert-Butyl 3-(2,2-dibroMovinyl)azetidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(2,2-dibromoethenyl)azetidine-1-carboxylate (CAS 1197419-14-9) is a chemical compound with the molecular formula C10H15Br2NO2 and a molecular weight of 341.04 g/mol. IUPAC name: tert-butyl 3-(2,2-dibromoethenyl)azetidine-1-carboxylate. InChIKey: HHYMZESVKOHDPJ-UHFFFAOYSA-N.
| Molecular formula | C10H15Br2NO2 |
|---|---|
| Molecular weight | 341.04 g/mol |
| IUPAC name | tert-butyl 3-(2,2-dibromoethenyl)azetidine-1-carboxylate |
| InChIKey | HHYMZESVKOHDPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C=C(Br)Br |
Computed by PubChem (NCBI)