CAS 1197481-18-7 is the registry number for 2-((3-Bromophenyl)amino)-N-(2,2,2-trifluoroethyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromoanilino)-N-(2,2,2-trifluoroethyl)acetamide (CAS 1197481-18-7) is a chemical compound with the molecular formula C10H10BrF3N2O and a molecular weight of 311.10 g/mol. IUPAC name: 2-(3-bromoanilino)-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: SMPKFBVEKFWMKR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3N2O |
|---|---|
| Molecular weight | 311.10 g/mol |
| IUPAC name | 2-(3-bromoanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | SMPKFBVEKFWMKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NCC(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)