Products 1197543-53-5
CAS 1197543-53-5 is the registry number for 5-((5-Bromo-2-fluorobenzyl)amino)-4-chloropyridazin-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(5-bromo-2-fluorophenyl)methylamino]-5-chloro-1H-pyridazin-6-one (CAS 1197543-53-5) is a chemical compound with the molecular formula C11H8BrClFN3O and a molecular weight of 332.55 g/mol. IUPAC name: 4-[(5-bromo-2-fluorophenyl)methylamino]-5-chloro-1H-pyridazin-6-one. InChIKey: GLJBVMXQGHUKSX-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClFN3O |
|---|---|
| Molecular weight | 332.55 g/mol |
| IUPAC name | 4-[(5-bromo-2-fluorophenyl)methylamino]-5-chloro-1H-pyridazin-6-one |
| InChIKey | GLJBVMXQGHUKSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CNC2=C(C(=O)NN=C2)Cl)F |
Computed by PubChem (NCBI)