CAS 119757-52-7 is the registry number for 1,2-BIS(3-(TRIFLUOROMETHYL)PHENYL)ETHYNE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(trifluoromethyl)-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]benzene (CAS 119757-52-7) is a chemical compound with the molecular formula C16H8F6 and a molecular weight of 314.22 g/mol. IUPAC name: 1-(trifluoromethyl)-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]benzene. InChIKey: DVTDJNNYVSWCNP-UHFFFAOYSA-N.
| Molecular formula | C16H8F6 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | 1-(trifluoromethyl)-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]benzene |
| InChIKey | DVTDJNNYVSWCNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C#CC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)