CAS 1197840-25-7 is the registry number for 4-(((4-Fluorophenyl)sulfonyl)methyl)-3,5-dimethylisoxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-fluorophenyl)sulfonylmethyl]-3,5-dimethyl-1,2-oxazole (CAS 1197840-25-7) is a chemical compound with the molecular formula C12H12FNO3S and a molecular weight of 269.29 g/mol. IUPAC name: 4-[(4-fluorophenyl)sulfonylmethyl]-3,5-dimethyl-1,2-oxazole. InChIKey: VFURFCUTPQADQK-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO3S |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)sulfonylmethyl]-3,5-dimethyl-1,2-oxazole |
| InChIKey | VFURFCUTPQADQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)