CAS 1197879-16-5 appears in our catalog under these names: GPR4 antagonist 1, 2-Ethyl-3-(4-((E)-3-(4-isopropylpiperazin-1-yl)propenyl)benzyl)-5,7-dimethyl-3H-imidazo(4,5-b)pyridine, GPR4 antagonist 1, 98.92%, 98.92%, GPR4 antagonist 1, 98.92%, GPR4 antagonist 1 (Standard). Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 10 mg, 25 mg, 50 mg.
2-ethyl-5,7-dimethyl-3-[[4-[(E)-3-(4-propan-2-ylpiperazin-1-yl)prop-1-enyl]phenyl]methyl]imidazo[4,5-b]pyridine (CAS 1197879-16-5) is a chemical compound with the molecular formula C27H37N5 and a molecular weight of 431.6 g/mol. IUPAC name: 2-ethyl-5,7-dimethyl-3-[[4-[(E)-3-(4-propan-2-ylpiperazin-1-yl)prop-1-enyl]phenyl]methyl]imidazo[4,5-b]pyridine. InChIKey: UAMIBPKKKLTAKG-BQYQJAHWSA-N.
| Molecular formula | C27H37N5 |
|---|---|
| Molecular weight | 431.6 g/mol |
| IUPAC name | 2-ethyl-5,7-dimethyl-3-[[4-[(E)-3-(4-propan-2-ylpiperazin-1-yl)prop-1-enyl]phenyl]methyl]imidazo[4,5-b]pyridine |
| InChIKey | UAMIBPKKKLTAKG-BQYQJAHWSA-N |
| SMILES | CCC1=NC2=C(N1CC3=CC=C(C=C3)/C=C/CN4CCN(CC4)C(C)C)N=C(C=C2C)C |
Computed by PubChem (NCBI)