CAS 1197896-79-9 appears in our catalog under these names: NITD-2, 98%, NITD-2/ 99.72% (existing batch purity), NITD–2, NITD-2 98%, 2-((3-(1-Benzyl-1H-pyrazol-4-yl)phenyl)sulfonamido)benzoic acid. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 200mg, 100 mg.
2-[[3-(1-benzylpyrazol-4-yl)phenyl]sulfonylamino]benzoic acid (CAS 1197896-79-9) is a chemical compound with the molecular formula C23H19N3O4S and a molecular weight of 433.5 g/mol. IUPAC name: 2-[[3-(1-benzylpyrazol-4-yl)phenyl]sulfonylamino]benzoic acid. InChIKey: PHQOBFYGHBBCBV-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O4S |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 2-[[3-(1-benzylpyrazol-4-yl)phenyl]sulfonylamino]benzoic acid |
| InChIKey | PHQOBFYGHBBCBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)C3=CC(=CC=C3)S(=O)(=O)NC4=CC=CC=C4C(=O)O |
Computed by PubChem (NCBI)