CAS 1197953-49-3 appears in our catalog under these names: Brigatinib Impurity 2, (2–((2,5–Dichloropyrimidin–4–yl)amino)phenyl)dimethylphosphine oxide, (2-((2,5-Dichloropyrimidin-4-yl)amino)phenyl)dimethylphosphine oxide 96%, (2-((2,5-Dichloropyrimidin-4-yl)amino)phenyl)dimethylphosphine oxide, 96%, 96%, (2-((2,5-Dichloropyrimidin-4-yl)amino)phenyl)dimethylphosphine oxide, 95%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 100g, 250mg, 5g, 10g, 25g, 100mg.
2,5-dichloro-N-(2-dimethylphosphorylphenyl)pyrimidin-4-amine (CAS 1197953-49-3) is a chemical compound with the molecular formula C12H12Cl2N3OP and a molecular weight of 316.12 g/mol. IUPAC name: 2,5-dichloro-N-(2-dimethylphosphorylphenyl)pyrimidin-4-amine. InChIKey: XIKUAKVCJMVXCI-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N3OP |
|---|---|
| Molecular weight | 316.12 g/mol |
| IUPAC name | 2,5-dichloro-N-(2-dimethylphosphorylphenyl)pyrimidin-4-amine |
| InChIKey | XIKUAKVCJMVXCI-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC=CC=C1NC2=NC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)