CAS 1197956-03-8 appears in our catalog under these names: (4-Amino-3-methoxyphenyl)dimethylphosphine oxide, 95%, 95%, (4-Amino-3-methoxyphenyl)dimethylphosphine oxide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 5g.
4-dimethylphosphoryl-2-methoxyaniline (CAS 1197956-03-8) is a chemical compound with the molecular formula C9H14NO2P and a molecular weight of 199.19 g/mol. IUPAC name: 4-dimethylphosphoryl-2-methoxyaniline. InChIKey: XSUFWLZYYKQQRC-UHFFFAOYSA-N.
| Molecular formula | C9H14NO2P |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 4-dimethylphosphoryl-2-methoxyaniline |
| InChIKey | XSUFWLZYYKQQRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)P(=O)(C)C)N |
Computed by PubChem (NCBI)