CAS 1197956-33-4 is the registry number for (4-Amino-3-chlorophenyl)dimethylphosphine oxide, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-4-dimethylphosphorylaniline (CAS 1197956-33-4) is a chemical compound with the molecular formula C8H11ClNOP and a molecular weight of 203.60 g/mol. IUPAC name: 2-chloro-4-dimethylphosphorylaniline. InChIKey: RTWCQPPJGDFVSO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClNOP |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | 2-chloro-4-dimethylphosphorylaniline |
| InChIKey | RTWCQPPJGDFVSO-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC(=C(C=C1)N)Cl |
Computed by PubChem (NCBI)