CAS 119802-69-6 appears in our catalog under these names: Bupropion Impurity Q, Bupropion Impurity 23. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-1-(3-chlorophenyl)propan-1-one (CAS 119802-69-6) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2-amino-1-(3-chlorophenyl)propan-1-one. InChIKey: RDWWHMAISJGIDU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 2-amino-1-(3-chlorophenyl)propan-1-one |
| InChIKey | RDWWHMAISJGIDU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)N |
Computed by PubChem (NCBI)