Products 1198080-03-3
CAS 1198080-03-3 appears in our catalog under these names: Propargyl-PEG6-N3, Propargyl–PEG6–N3, 3-(2-(2-(2-(2-(2-(2-Azidoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)prop-1-yne, Propargyl-PEG6-N3, 95.0%, 1-Azido-3,6,9,12,15,18-hexaoxahenicos-20-yne, 95%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 2mg, 100mg, 250mg, 500mg, 10 mg, 50 mg, 25 mg, 250 mg.
3-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne (CAS 1198080-03-3) is a chemical compound with the molecular formula C15H27N3O6 and a molecular weight of 345.39 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne. InChIKey: PZHVNVDINOLKDX-UHFFFAOYSA-N.
| Molecular formula | C15H27N3O6 |
|---|---|
| Molecular weight | 345.39 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-yne |
| InChIKey | PZHVNVDINOLKDX-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)