CAS 1198084-47-7 is the registry number for 4-(Chlorosulfonyl)-3-methyl-1,2,5-oxadiazole 2-Oxide, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-sulfonyl chloride (CAS 1198084-47-7) is a chemical compound with the molecular formula C3H3ClN2O4S and a molecular weight of 198.59 g/mol. IUPAC name: 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-sulfonyl chloride. InChIKey: HTNMGIZAIKSRTA-UHFFFAOYSA-N.
| Molecular formula | C3H3ClN2O4S |
|---|---|
| Molecular weight | 198.59 g/mol |
| IUPAC name | 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-sulfonyl chloride |
| InChIKey | HTNMGIZAIKSRTA-UHFFFAOYSA-N |
| SMILES | CC1=[N+](ON=C1S(=O)(=O)Cl)[O-] |
Computed by PubChem (NCBI)