CAS 119813-24-0 is the registry number for Sodium 3-methoxy-2-methyl-3-oxopropane-1-sulfinate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Sodium 3-methoxy-2-methyl-3-oxopropane-1-sulfinate (CAS 119813-24-0) is a chemical compound with the molecular formula C5H9NaO4S and a molecular weight of 188.18 g/mol. IUPAC name: sodium 3-methoxy-2-methyl-3-oxopropane-1-sulfinate. InChIKey: FYSJYIZBBVRTOF-UHFFFAOYSA-M.
| Molecular formula | C5H9NaO4S |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | sodium 3-methoxy-2-methyl-3-oxopropane-1-sulfinate |
| InChIKey | FYSJYIZBBVRTOF-UHFFFAOYSA-M |
| SMILES | CC(CS(=O)[O-])C(=O)OC.[Na+] |
Computed by PubChem (NCBI)