CAS 1198290-38-8 appears in our catalog under these names: Poly(9,9-dihexylfluorenyl-2,7-diyl) end capped with dimethylphenyl, C3-BTBT 98%. Offered by: Lumtec, Ambeed. Available pack sizes: On request, 100mg, 250mg, 1g.
2,7-dipropyl-[1]benzothiolo[3,2-b][1]benzothiole (CAS 1198290-38-8) is a chemical compound with the molecular formula C20H20S2 and a molecular weight of 324.5 g/mol. IUPAC name: 2,7-dipropyl-[1]benzothiolo[3,2-b][1]benzothiole. InChIKey: ZYZVKQVHPQZAHM-UHFFFAOYSA-N.
| Molecular formula | C20H20S2 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | 2,7-dipropyl-[1]benzothiolo[3,2-b][1]benzothiole |
| InChIKey | ZYZVKQVHPQZAHM-UHFFFAOYSA-N |
| SMILES | CCCC1=CC2=C(C=C1)C3=C(S2)C4=C(S3)C=C(C=C4)CCC |
Computed by PubChem (NCBI)