Products 1198309-73-7
CAS 1198309-73-7 is the registry number for AZD–8418. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 50mg.
5-[7-chloro-2-[(1S)-1-cyclopropylethyl]-1-oxo-3H-isoindol-5-yl]-N,N-dimethyl-1,2-oxazole-3-carboxamide (CAS 1198309-73-7) is a chemical compound with the molecular formula C19H20ClN3O3 and a molecular weight of 373.8 g/mol. IUPAC name: 5-[7-chloro-2-[(1S)-1-cyclopropylethyl]-1-oxo-3H-isoindol-5-yl]-N,N-dimethyl-1,2-oxazole-3-carboxamide. InChIKey: MCPBSUCAISQZQK-JTQLQIEISA-N.
| Molecular formula | C19H20ClN3O3 |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | 5-[7-chloro-2-[(1S)-1-cyclopropylethyl]-1-oxo-3H-isoindol-5-yl]-N,N-dimethyl-1,2-oxazole-3-carboxamide |
| InChIKey | MCPBSUCAISQZQK-JTQLQIEISA-N |
| SMILES | C[C@@H](C1CC1)N2CC3=C(C2=O)C(=CC(=C3)C4=CC(=NO4)C(=O)N(C)C)Cl |
Computed by PubChem (NCBI)
Synonyms:
Azd 8418, orb1738218