CAS 1198320-35-2 appears in our catalog under these names: tert-Butyl (3S)-3-{((tert-butoxy)carbonyl)amino}-3-cyanopropanoate, 95%, tert-Butyl (3S)-3-{((tert-butoxy)carbonyl)amino}-3-cyanopropanoate, tert-butyl (3S)-3-{[(tert-butoxy)carbonyl]amino}-3-cyanopropanoate, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg, 5g.
Tert-butyl (3S)-3-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1198320-35-2) is a chemical compound with the molecular formula C13H22N2O4 and a molecular weight of 270.32 g/mol. IUPAC name: tert-butyl (3S)-3-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: YHQGGLCCSOSZCJ-VIFPVBQESA-N.
| Molecular formula | C13H22N2O4 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | tert-butyl (3S)-3-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | YHQGGLCCSOSZCJ-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C#N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)