CAS 1198396-38-1 is the registry number for 11,11-Dimethyl-11H-benzo[b]fluorene, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
11,11-dimethylbenzo[b]fluorene (CAS 1198396-38-1) is a chemical compound with the molecular formula C19H16 and a molecular weight of 244.3 g/mol. IUPAC name: 11,11-dimethylbenzo[b]fluorene. InChIKey: DDOYWEQCACYMDI-UHFFFAOYSA-N.
| Molecular formula | C19H16 |
|---|---|
| Molecular weight | 244.3 g/mol |
| IUPAC name | 11,11-dimethylbenzo[b]fluorene |
| InChIKey | DDOYWEQCACYMDI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC4=CC=CC=C4C=C31)C |
Computed by PubChem (NCBI)