CAS 1198475-31-8 appears in our catalog under these names: 6,8-Dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine, 95%, 95%, 6,8-Dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6,8-dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine (CAS 1198475-31-8) is a chemical compound with the molecular formula C6H4Br2N4 and a molecular weight of 291.93 g/mol. IUPAC name: 6,8-dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: RRSNBXYGYCPJBV-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N4 |
|---|---|
| Molecular weight | 291.93 g/mol |
| IUPAC name | 6,8-dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | RRSNBXYGYCPJBV-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(N=C(C2=N1)Br)Br |
Computed by PubChem (NCBI)