CAS 1198475-48-7 is the registry number for 2-Chloro-6-phenyl-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(2-chloro-6-phenyl-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole (CAS 1198475-48-7) is a chemical compound with the molecular formula C14H7ClF3N3O and a molecular weight of 325.67 g/mol. IUPAC name: 3-(2-chloro-6-phenyl-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole. InChIKey: MWCZTICCTDGJJU-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF3N3O |
|---|---|
| Molecular weight | 325.67 g/mol |
| IUPAC name | 3-(2-chloro-6-phenyl-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
| InChIKey | MWCZTICCTDGJJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(C=C2)C3=NOC(=N3)C(F)(F)F)Cl |
Computed by PubChem (NCBI)