Products 1198617-89-8
CAS 1198617-89-8 appears in our catalog under these names: Fmoc-L-Lys(N3-Gly)-OH, Fmoc-L-Lys(N3-Gly)-OH 98%. Offered by: Iris Biotech, Ambeed, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10mg, 25mg.
(2S)-6-[(2-azidoacetyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1198617-89-8) is a chemical compound with the molecular formula C23H25N5O5 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-6-[(2-azidoacetyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: IDSBAHSRCNJNIC-FQEVSTJZSA-N.
| Molecular formula | C23H25N5O5 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-6-[(2-azidoacetyl)amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | IDSBAHSRCNJNIC-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCNC(=O)CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)