Products 119888-86-7
CAS 119888-86-7 appears in our catalog under these names: tert-Butyl 2,2-dimethyl-3-oxobutanoate, 95%, tert-Butyl 2,2-dimethyl-3-oxobutanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Tert-butyl 2,2-dimethyl-3-oxobutanoate (CAS 119888-86-7) is a chemical compound with the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-3-oxobutanoate. InChIKey: WWYNTBCZPIPUDJ-UHFFFAOYSA-N.
| Molecular formula | C10H18O3 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl 2,2-dimethyl-3-oxobutanoate |
| InChIKey | WWYNTBCZPIPUDJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)