CAS 1199-47-9 appears in our catalog under these names: 2–Amino–5–tert–butylphenol, 2-Amino-5-tert-butylphenol. Offered by: GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 2,5g.
2-amino-5-tert-butylphenol (CAS 1199-47-9) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 2-amino-5-tert-butylphenol. InChIKey: HFCOMOKKPQIADM-UHFFFAOYSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | 2-amino-5-tert-butylphenol |
| InChIKey | HFCOMOKKPQIADM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)O |
Computed by PubChem (NCBI)