CAS 1199-49-1 appears in our catalog under these names: 3-isopropyl-5-(trichloromethyl)-1,2,4-oxadiazole, 3-Isopropyl-5-(trichloromethyl)-1,2,4-oxadiazole, 97%, 97%, 3-Isopropyl-5-(trichloromethyl)-1,2,4-oxadiazole, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
3-propan-2-yl-5-(trichloromethyl)-1,2,4-oxadiazole (CAS 1199-49-1) is a chemical compound with the molecular formula C6H7Cl3N2O and a molecular weight of 229.5 g/mol. IUPAC name: 3-propan-2-yl-5-(trichloromethyl)-1,2,4-oxadiazole. InChIKey: NLZBSAZGBAZSOS-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl3N2O |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | 3-propan-2-yl-5-(trichloromethyl)-1,2,4-oxadiazole |
| InChIKey | NLZBSAZGBAZSOS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)