CAS 1199215-97-8 is the registry number for 1-Ethyl-4-nitro-1h-pyrazole-5-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-ethyl-4-nitropyrazole-5-carbonyl chloride (CAS 1199215-97-8) is a chemical compound with the molecular formula C6H6ClN3O3 and a molecular weight of 203.58 g/mol. IUPAC name: 1-ethyl-4-nitropyrazole-5-carbonyl chloride. InChIKey: SEGMBFUPXYZVNI-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O3 |
|---|---|
| Molecular weight | 203.58 g/mol |
| IUPAC name | 1-ethyl-4-nitropyrazole-5-carbonyl chloride |
| InChIKey | SEGMBFUPXYZVNI-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)