CAS 1199773-17-5 is the registry number for 1-(4-(4-Bromopyrazol-1-yl)phenylsulfonyl)piperidine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-[4-(4-bromopyrazol-1-yl)phenyl]sulfonylpiperidine (CAS 1199773-17-5) is a chemical compound with the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. IUPAC name: 1-[4-(4-bromopyrazol-1-yl)phenyl]sulfonylpiperidine. InChIKey: GRSHOZSMDJHJEH-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN3O2S |
|---|---|
| Molecular weight | 370.27 g/mol |
| IUPAC name | 1-[4-(4-bromopyrazol-1-yl)phenyl]sulfonylpiperidine |
| InChIKey | GRSHOZSMDJHJEH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N3C=C(C=N3)Br |
Computed by PubChem (NCBI)