Products 1199944-04-1
CAS 1199944-04-1 appears in our catalog under these names: NaV1·2/1·6 channel blocker–1, NaV1.2/1.6 channel blocker-1, 98.89%, NaV1.2/1.6 channel blocker-1/ 99.54% (existing batch purity), 2-Methyl-3-propyl-5H-benzo[e]imidazo[1,2-c][1,3]oxazine-5-thione, 95%, 95%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 10 mg, 50 mg.
2-methyl-3-propylimidazo[1,2-c][1,3]benzoxazine-5-thione (CAS 1199944-04-1) is a chemical compound with the molecular formula C14H14N2OS and a molecular weight of 258.34 g/mol. IUPAC name: 2-methyl-3-propylimidazo[1,2-c][1,3]benzoxazine-5-thione. InChIKey: OEWGFBGGWFYYNM-UHFFFAOYSA-N.
| Molecular formula | C14H14N2OS |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 2-methyl-3-propylimidazo[1,2-c][1,3]benzoxazine-5-thione |
| InChIKey | OEWGFBGGWFYYNM-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N=C2N1C(=S)OC3=CC=CC=C32)C |
Computed by PubChem (NCBI)