CAS 120-52-5 appears in our catalog under these names: 4,4'-Dibenzoylquinone dioxime, 98%, 4,4–Dibenzoylquinone Dioxime, 4,4'-Dibenzoylquinone Dioxime, >98.0%(N). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 500g.
[(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate (CAS 120-52-5) is a chemical compound with the molecular formula C20H14N2O4 and a molecular weight of 346.3 g/mol. IUPAC name: [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate. InChIKey: WMVSVUVZSYRWIY-UHFFFAOYSA-N.
| Molecular formula | C20H14N2O4 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
| InChIKey | WMVSVUVZSYRWIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)ON=C2C=CC(=NOC(=O)C3=CC=CC=C3)C=C2 |
Computed by PubChem (NCBI)