CAS 1200-89-1 appears in our catalog under these names: 1,4,4A,8A-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione, 95%, 1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione, 1,4,4a,8a-Tetrahydro-1,4-methano-naphthalene-5,8-dione, 1,4,4a,8a-Tetrahydro-1,4-methanonaphthalene-5,8-dione, 98%, 98%, 1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50g, 25g, 50mg, 100mg, 250mg, 500mg.
Tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (CAS 1200-89-1) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione. InChIKey: FQLRTGXTYFCECH-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| InChIKey | FQLRTGXTYFCECH-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)C=CC3=O |
Computed by PubChem (NCBI)