Products 120020-26-0
CAS 120020-26-0 appears in our catalog under these names: Artelinic acid, Artelinic acid/ 97.8% (existing batch purity), Artelinic acid, Artelinic acid, 98.14%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 5 mg, 25 mg.
4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid (CAS 120020-26-0) is a chemical compound with the molecular formula C23H30O7 and a molecular weight of 418.5 g/mol. IUPAC name: 4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid. InChIKey: UVNHKOOJXSALHN-ILQPJIFQSA-N.
| Molecular formula | C23H30O7 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxymethyl]benzoic acid |
| InChIKey | UVNHKOOJXSALHN-ILQPJIFQSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C |
Computed by PubChem (NCBI)