CAS 120033-19-4 is the registry number for 10-(tert-Butyldimethylsilyl)-4,6-dichloro-10H-phenoxazine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl-(4,6-dichlorophenoxazin-10-yl)-dimethylsilane (CAS 120033-19-4) is a chemical compound with the molecular formula C18H21Cl2NOSi and a molecular weight of 366.4 g/mol. IUPAC name: tert-butyl-(4,6-dichlorophenoxazin-10-yl)-dimethylsilane. InChIKey: RQMHINOWMPTPBG-UHFFFAOYSA-N.
| Molecular formula | C18H21Cl2NOSi |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | tert-butyl-(4,6-dichlorophenoxazin-10-yl)-dimethylsilane |
| InChIKey | RQMHINOWMPTPBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)N1C2=C(C(=CC=C2)Cl)OC3=C1C=CC=C3Cl |
Computed by PubChem (NCBI)