CAS 120066-53-7 appears in our catalog under these names: Mn(II)–DO3A sodium, Mn(II)-DO3A (sodium), 70.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 25 mg, 50 mg, 100 mg, 10 mg.
Sodium;2-[4,7-bis(carboxylatomethyl)-1,4,7-triaza-10-azanidacyclododec-1-yl]acetate;manganese(2+) (CAS 120066-53-7) is a chemical compound with the molecular formula C14H22MnN4NaO6- and a molecular weight of 420.28 g/mol. IUPAC name: sodium;2-[4,7-bis(carboxylatomethyl)-1,4,7-triaza-10-azanidacyclododec-1-yl]acetate;manganese(2+). InChIKey: OVRMTVHRWWZGAL-UHFFFAOYSA-K.
| Molecular formula | C14H22MnN4NaO6- |
|---|---|
| Molecular weight | 420.28 g/mol |
| IUPAC name | sodium;2-[4,7-bis(carboxylatomethyl)-1,4,7-triaza-10-azanidacyclododec-1-yl]acetate;manganese(2+) |
| InChIKey | OVRMTVHRWWZGAL-UHFFFAOYSA-K |
| SMILES | C1CN(CCN(CCN(CC[N-]1)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Na+].[Mn+2] |
Computed by PubChem (NCBI)