CAS 120066-54-8 appears in our catalog under these names: Gadoteridol, Gadoteridol/ 98.63% (existing batch purity), Gadoteridol (SQ–32692). Offered by: Chemat Brand, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml water).
2-[4,7-bis(carboxylatomethyl)-10-(2-hydroxypropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (CAS 120066-54-8) is a chemical compound with the molecular formula C17H29GdN4O7 and a molecular weight of 558.7 g/mol. IUPAC name: 2-[4,7-bis(carboxylatomethyl)-10-(2-hydroxypropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+). InChIKey: DPNNNPAKRZOSMO-UHFFFAOYSA-K.
| Molecular formula | C17H29GdN4O7 |
|---|---|
| Molecular weight | 558.7 g/mol |
| IUPAC name | 2-[4,7-bis(carboxylatomethyl)-10-(2-hydroxypropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| InChIKey | DPNNNPAKRZOSMO-UHFFFAOYSA-K |
| SMILES | CC(CN1CCN(CCN(CCN(CC1)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-])O.[Gd+3] |
Computed by PubChem (NCBI)