CAS 120068-81-7 appears in our catalog under these names: Fipronil Impurity 2, Fipronil Impurity 5, 5-Amino-1-(2-chloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile (CAS 120068-81-7) is a chemical compound with the molecular formula C11H6ClF3N4 and a molecular weight of 286.64 g/mol. IUPAC name: 5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile. InChIKey: HRFNJPMZWGNBHK-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF3N4 |
|---|---|
| Molecular weight | 286.64 g/mol |
| IUPAC name | 5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
| InChIKey | HRFNJPMZWGNBHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)N2C(=CC(=N2)C#N)N |
Computed by PubChem (NCBI)