CAS 12007-60-2 appears in our catalog under these names: Lithium tetraborate, 99.998 %, 100% Lithium tetraborate, granular, Lithium tetraborate/ 99%, Lithium tetraborate/ 99.95+%, Lithium tetraborate. Offered by: Chemat Brand, VHG, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 1kg, 500g, 100g, 250g, 25g, *5x1kg, 50g.
Dilithium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane (CAS 12007-60-2) is a chemical compound with the molecular formula B4Li2O7 and a molecular weight of 169.2 g/mol. IUPAC name: dilithium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane. InChIKey: XFOCQAMEVCAHGV-UHFFFAOYSA-N.
| Molecular formula | B4Li2O7 |
|---|---|
| Molecular weight | 169.2 g/mol |
| IUPAC name | dilithium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane |
| InChIKey | XFOCQAMEVCAHGV-UHFFFAOYSA-N |
| SMILES | [Li+].[Li+].B1(OB2OB(OB(O1)O2)[O-])[O-] |
Computed by PubChem (NCBI)