CAS 12007-89-5 appears in our catalog under these names: Ammonium pentaborate, tetrahydrate, 98%, Ammonium pentaborate octahydrate, 95%, Ammonium Pentaborate, AMMONIUM PENTABORATE, ≥99%, ≥99%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 500g, 1kg, 100g, 25g, 2.5kg.
Azanium (7-oxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonan-3-yl)oxy-oxoborane (CAS 12007-89-5) is a chemical compound with the molecular formula B5H4NO8 and a molecular weight of 200.1 g/mol. IUPAC name: azanium (7-oxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonan-3-yl)oxy-oxoborane. InChIKey: OEAWHXRHGIIPBU-UHFFFAOYSA-O.
| Molecular formula | B5H4NO8 |
|---|---|
| Molecular weight | 200.1 g/mol |
| IUPAC name | azanium (7-oxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonan-3-yl)oxy-oxoborane |
| InChIKey | OEAWHXRHGIIPBU-UHFFFAOYSA-O |
| SMILES | B(=O)OB1OB2OB(OB(O2)O1)[O-].[NH4+] |
Computed by PubChem (NCBI)