Products 120097-92-9
CAS 120097-92-9 is the registry number for 7U85 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-2-[(7-methylbenzo[c]carbazol-10-yl)methylamino]propane-1,3-diol;hydrochloride (CAS 120097-92-9) is a chemical compound with the molecular formula C22H25ClN2O2 and a molecular weight of 384.9 g/mol. IUPAC name: 2-methyl-2-[(7-methylbenzo[c]carbazol-10-yl)methylamino]propane-1,3-diol;hydrochloride. InChIKey: ABKIVLVKVDITIK-UHFFFAOYSA-N.
| Molecular formula | C22H25ClN2O2 |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | 2-methyl-2-[(7-methylbenzo[c]carbazol-10-yl)methylamino]propane-1,3-diol;hydrochloride |
| InChIKey | ABKIVLVKVDITIK-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)NCC1=CC2=C(C=C1)N(C3=C2C4=CC=CC=C4C=C3)C.Cl |
Computed by PubChem (NCBI)