CAS 1201186-89-1 is the registry number for Rel-(3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-N-methylpyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-N-methylpyrrolidin-3-amine (CAS 1201186-89-1) is a chemical compound with the molecular formula C18H20Cl2N2 and a molecular weight of 335.3 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-N-methylpyrrolidin-3-amine. InChIKey: SJIPNRIBOFSJNO-QAPCUYQASA-N.
| Molecular formula | C18H20Cl2N2 |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-N-methylpyrrolidin-3-amine |
| InChIKey | SJIPNRIBOFSJNO-QAPCUYQASA-N |
| SMILES | CN[C@H]1CN(C[C@@H]1C2=CC(=C(C=C2)Cl)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)