CAS 1201226-16-5 appears in our catalog under these names: (5-(ETHYLAMINO)-5-OXOPENTYL)TRIPHENYLPHOSPHONIUM BROMIDE, 98%, (5-(Ethylamino)-5-Oxopentyl)Triphenylphosphonium Bromide, 98%, 98%, Bimatoprost Impurity 7. Offered by: Fluorochem, Chemat, Chemat Brand. Available pack sizes: 1g, 5g, 10g, 25g, on request.
[5-(ethylamino)-5-oxopentyl]-triphenylphosphanium bromide (CAS 1201226-16-5) is a chemical compound with the molecular formula C25H29BrNOP and a molecular weight of 470.4 g/mol. IUPAC name: [5-(ethylamino)-5-oxopentyl]-triphenylphosphanium bromide. InChIKey: AGIMDSXEQYKHQU-UHFFFAOYSA-N.
| Molecular formula | C25H29BrNOP |
|---|---|
| Molecular weight | 470.4 g/mol |
| IUPAC name | [5-(ethylamino)-5-oxopentyl]-triphenylphosphanium bromide |
| InChIKey | AGIMDSXEQYKHQU-UHFFFAOYSA-N |
| SMILES | CCNC(=O)CCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)