CAS 1201331-15-8 is the registry number for Trifluoro({[4-(trifluoromethoxy)phenyl]methyl})boranuide potassium, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Potassium trifluoro-[[4-(trifluoromethoxy)phenyl]methyl]boranuide (CAS 1201331-15-8) is a chemical compound with the molecular formula C8H6BF6KO and a molecular weight of 282.03 g/mol. IUPAC name: potassium trifluoro-[[4-(trifluoromethoxy)phenyl]methyl]boranuide. InChIKey: KKWNILYXMXLMHM-UHFFFAOYSA-N.
| Molecular formula | C8H6BF6KO |
|---|---|
| Molecular weight | 282.03 g/mol |
| IUPAC name | potassium trifluoro-[[4-(trifluoromethoxy)phenyl]methyl]boranuide |
| InChIKey | KKWNILYXMXLMHM-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=C(C=C1)OC(F)(F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)