CAS 1201644-43-0 is the registry number for N-Benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 1201644-43-0) is a chemical compound with the molecular formula C19H23BN2O3 and a molecular weight of 338.2 g/mol. IUPAC name: N-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: VQMJENZEDUSFPG-UHFFFAOYSA-N.
| Molecular formula | C19H23BN2O3 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | N-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | VQMJENZEDUSFPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)