CAS 1201657-29-5 is the registry number for 2-Chloro-N,6-dimethylpyrimidine-4-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-N,6-dimethylpyrimidine-4-carboxamide (CAS 1201657-29-5) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-N,6-dimethylpyrimidine-4-carboxamide. InChIKey: VXDUVRFGTXTIOF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-N,6-dimethylpyrimidine-4-carboxamide |
| InChIKey | VXDUVRFGTXTIOF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)C(=O)NC |
Computed by PubChem (NCBI)