CAS 1201663-81-1 appears in our catalog under these names: 3–Chloro–5–(chlorosulfonyl)–4–hydroxybenzoic acid, 3-chloro-5-(chlorosulfonyl)-4-hydroxybenzoic acid, 3-Chloro-5-(chlorosulfonyl)-4-hydroxybenzoic acid, 95%, 95%, 3-CHLORO-5-(CHLOROSULFONYL)-4-HYDROXYBENZOIC ACID, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
3-chloro-5-chlorosulfonyl-4-hydroxybenzoic acid (CAS 1201663-81-1) is a chemical compound with the molecular formula C7H4Cl2O5S and a molecular weight of 271.07 g/mol. IUPAC name: 3-chloro-5-chlorosulfonyl-4-hydroxybenzoic acid. InChIKey: AWRFXYMSFNUBMN-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O5S |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | 3-chloro-5-chlorosulfonyl-4-hydroxybenzoic acid |
| InChIKey | AWRFXYMSFNUBMN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1S(=O)(=O)Cl)O)Cl)C(=O)O |
Computed by PubChem (NCBI)