CAS 1201685-71-3 appears in our catalog under these names: (3R,4S,5S)-4,5-Dihydroxy-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylic acid, 95%, Oseltamivir Impurity 134, (3R,4S,5S)-3-(1-Ethylpropoxy)-4,5-dihydroxy-1-cyclohexene-1-carboxylic Acid Ethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl (3R,4S,5S)-4,5-dihydroxy-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 1201685-71-3) is a chemical compound with the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. IUPAC name: ethyl (3R,4S,5S)-4,5-dihydroxy-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: YONORCNNWKSULH-XQQFMLRXSA-N.
| Molecular formula | C14H24O5 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | ethyl (3R,4S,5S)-4,5-dihydroxy-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | YONORCNNWKSULH-XQQFMLRXSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@@H]1O)O)C(=O)OCC |
Computed by PubChem (NCBI)