Products 1201808-21-0

CAS 1201808-21-0 is the registry number for 3,4-Diphenylmethylidene Luteolin. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one (CAS 1201808-21-0) is a chemical compound with the molecular formula C28H18O6 and a molecular weight of 450.4 g/mol. IUPAC name: 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one. InChIKey: LXZNQTVZNYMKOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC28H18O6
Molecular weight450.4 g/mol
IUPAC name2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5,7-dihydroxychromen-4-one
InChIKeyLXZNQTVZNYMKOZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2(OC3=C(O2)C=C(C=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)C6=CC=CC=C6

Computed by PubChem (NCBI)